C23H21NO3S — CID 101226583
(3R,4R)-1,4-bis(4-methoxyphenyl)-3-phenylsulfanylazetidin-2-one (PubChem CID 101226583) has the molecular formula C23H21NO3S and a molecular weight of 391.49 g/mol. Its IUPAC name is (3R,4R)-1,4-bis(4-methoxyphenyl)-3-phenylsulfanylazetidin-2-one.
| Compound Name | (3R,4R)-1,4-bis(4-methoxyphenyl)-3-phenylsulfanylazetidin-2-one |
|---|---|
| PubChem CID | 101226583 |
| Molecular Formula | C23H21NO3S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (3R,4R)-1,4-bis(4-methoxyphenyl)-3-phenylsulfanylazetidin-2-one |
| SMILES | COc1ccc([C@@H]2[C@@H](Sc3ccccc3)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H21NO3S/c1-26-18-12-8-16(9-13-18)21-22(28-20-6-4-3-5-7-20)23(25)24(21)17-10-14-19(27-2)15-11-17/h3-15,21-22H,1-2H3/t21-,22-/m1/s1 |
| InChIKey | GHFSYBKRKZUTCP-FGZHOGPDSA-N |
| XLogP | 4.95 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |