C17H17NO4 — CID 11392395
(3S,4R)-3-hydroxy-1,4-bis(4-methoxyphenyl)azetidin-2-one (PubChem CID 11392395) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (3S,4R)-3-hydroxy-1,4-bis(4-methoxyphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-hydroxy-1,4-bis(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 11392395 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (3S,4R)-3-hydroxy-1,4-bis(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc([C@@H]2[C@H](O)C(=O)N2c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C17H17NO4/c1-21-13-7-3-11(4-8-13)15-16(19)17(20)18(15)12-5-9-14(22-2)10-6-12/h3-10,15-16,19H,1-2H3/t15-,16+/m1/s1 |
| InChIKey | XSJZCZIPTZAURU-CVEARBPZSA-N |
| XLogP | 2.15 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |