C14H13AcNO4 — CID 59880313
actinium;(4R)-4-(furan-2-yl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 59880313) has the molecular formula C14H13AcNO4 and a molecular weight of 486.26 g/mol. Its IUPAC name is actinium;(4R)-4-(furan-2-yl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | actinium;(4R)-4-(furan-2-yl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 59880313 |
| Molecular Formula | C14H13AcNO4 |
| Molecular Weight | 486.26 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | actinium;(4R)-4-(furan-2-yl)-3-hydroxy-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)C(O)[C@@H]2c2ccco2)cc1.[Ac] |
| InChI | InChI=1S/C14H13NO4.Ac/c1-18-10-6-4-9(5-7-10)15-12(13(16)14(15)17)11-3-2-8-19-11;/h2-8,12-13,16H,1H3;/t12-,13?;/m0./s1 |
| InChIKey | MEIYGZISJWKKGU-NQJMHYHOSA-N |
| XLogP | 1.74 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |