C15H15NO4 — CID 73312428
4-(furan-2-yl)-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one (PubChem CID 73312428) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is 4-(furan-2-yl)-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one.
| Compound Name | 4-(furan-2-yl)-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 73312428 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-(furan-2-yl)-3-methoxy-1-(4-methoxyphenyl)azetidin-2-one |
| SMILES | COc1ccc(N2C(=O)C(OC)C2c2ccco2)cc1 |
| InChI | InChI=1S/C15H15NO4/c1-18-11-7-5-10(6-8-11)16-13(12-4-3-9-20-12)14(19-2)15(16)17/h3-9,13-14H,1-2H3 |
| InChIKey | WUJSRIJBGXQIDK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |