C23H33NO4Si — CID 134920379
(3S,4R)-4-(furan-2-yl)-1-(4-methoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one (PubChem CID 134920379) has the molecular formula C23H33NO4Si and a molecular weight of 415.61 g/mol. Its IUPAC name is (3S,4R)-4-(furan-2-yl)-1-(4-methoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one.
| Compound Name | (3S,4R)-4-(furan-2-yl)-1-(4-methoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one |
|---|---|
| PubChem CID | 134920379 |
| Molecular Formula | C23H33NO4Si |
| Molecular Weight | 415.61 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | (3S,4R)-4-(furan-2-yl)-1-(4-methoxyphenyl)-3-tri(propan-2-yl)silyloxyazetidin-2-one |
| SMILES | COc1ccc(N2C(=O)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H]2c2ccco2)cc1 |
| InChI | InChI=1S/C23H33NO4Si/c1-15(2)29(16(3)4,17(5)6)28-22-21(20-9-8-14-27-20)24(23(22)25)18-10-12-19(26-7)13-11-18/h8-17,21-22H,1-7H3/t21-,22-/m0/s1 |
| InChIKey | RXAFQFGZUMFLQG-VXKWHMMOSA-N |
| XLogP | 5.94 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.61 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|