C19H15NO2 — CID 11346786
(3R,4R)-4-(furan-2-yl)-1,3-diphenylazetidin-2-one (PubChem CID 11346786) has the molecular formula C19H15NO2 and a molecular weight of 289.33 g/mol. Its IUPAC name is (3R,4R)-4-(furan-2-yl)-1,3-diphenylazetidin-2-one.
| Compound Name | (3R,4R)-4-(furan-2-yl)-1,3-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 11346786 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (3R,4R)-4-(furan-2-yl)-1,3-diphenylazetidin-2-one |
| SMILES | O=C1[C@H](c2ccccc2)[C@H](c2ccco2)N1c1ccccc1 |
| InChI | InChI=1S/C19H15NO2/c21-19-17(14-8-3-1-4-9-14)18(16-12-7-13-22-16)20(19)15-10-5-2-6-11-15/h1-13,17-18H/t17-,18+/m1/s1 |
| InChIKey | KJEPTODBJSYBBP-MSOLQXFVSA-N |
| XLogP | 4.15 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |