C15H13NO2 — CID 11424956
(3R,4S)-3-hydroxy-1,4-diphenylazetidin-2-one (PubChem CID 11424956) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is (3R,4S)-3-hydroxy-1,4-diphenylazetidin-2-one.
| Compound Name | (3R,4S)-3-hydroxy-1,4-diphenylazetidin-2-one |
|---|---|
| PubChem CID | 11424956 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | (3R,4S)-3-hydroxy-1,4-diphenylazetidin-2-one |
| SMILES | O=C1[C@H](O)[C@H](c2ccccc2)N1c1ccccc1 |
| InChI | InChI=1S/C15H13NO2/c17-14-13(11-7-3-1-4-8-11)16(15(14)18)12-9-5-2-6-10-12/h1-10,13-14,17H/t13-,14+/m0/s1 |
| InChIKey | NFENQWXNKKLJIX-UONOGXRCSA-N |
| XLogP | 2.14 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |