C15H13FN2O — CID 124503328
(3R,4S)-3-amino-1-(4-fluorophenyl)-4-phenylazetidin-2-one (PubChem CID 124503328) has the molecular formula C15H13FN2O and a molecular weight of 256.28 g/mol. Its IUPAC name is (3R,4S)-3-amino-1-(4-fluorophenyl)-4-phenylazetidin-2-one.
| Compound Name | (3R,4S)-3-amino-1-(4-fluorophenyl)-4-phenylazetidin-2-one |
|---|---|
| PubChem CID | 124503328 |
| Molecular Formula | C15H13FN2O |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | (3R,4S)-3-amino-1-(4-fluorophenyl)-4-phenylazetidin-2-one |
| SMILES | N[C@H]1C(=O)N(c2ccc(F)cc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H13FN2O/c16-11-6-8-12(9-7-11)18-14(13(17)15(18)19)10-4-2-1-3-5-10/h1-9,13-14H,17H2/t13-,14+/m1/s1 |
| InChIKey | WYYXBPDQRSEFSN-KGLIPLIRSA-N |
| XLogP | 2.24 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |