C15H12Cl2N2O — CID 124504103
(3S,4R)-3-amino-1,4-bis(4-chlorophenyl)azetidin-2-one (PubChem CID 124504103) has the molecular formula C15H12Cl2N2O and a molecular weight of 307.18 g/mol. Its IUPAC name is (3S,4R)-3-amino-1,4-bis(4-chlorophenyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-amino-1,4-bis(4-chlorophenyl)azetidin-2-one |
|---|---|
| PubChem CID | 124504103 |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | (3S,4R)-3-amino-1,4-bis(4-chlorophenyl)azetidin-2-one |
| SMILES | N[C@@H]1C(=O)N(c2ccc(Cl)cc2)[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H12Cl2N2O/c16-10-3-1-9(2-4-10)14-13(18)15(20)19(14)12-7-5-11(17)6-8-12/h1-8,13-14H,18H2/t13-,14+/m0/s1 |
| InChIKey | HRHQAAAKUDMQAK-UONOGXRCSA-N |
| XLogP | 3.41 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |