C10H11ClN2O — CID 95733150
(3R,4R)-3-amino-4-(4-chlorophenyl)-1-methylazetidin-2-one (PubChem CID 95733150) has the molecular formula C10H11ClN2O and a molecular weight of 210.66 g/mol. Its IUPAC name is (3R,4R)-3-amino-4-(4-chlorophenyl)-1-methylazetidin-2-one.
| Compound Name | (3R,4R)-3-amino-4-(4-chlorophenyl)-1-methylazetidin-2-one |
|---|---|
| PubChem CID | 95733150 |
| Molecular Formula | C10H11ClN2O |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (3R,4R)-3-amino-4-(4-chlorophenyl)-1-methylazetidin-2-one |
| SMILES | CN1C(=O)[C@H](N)[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClN2O/c1-13-9(8(12)10(13)14)6-2-4-7(11)5-3-6/h2-5,8-9H,12H2,1H3/t8-,9-/m1/s1 |
| InChIKey | QZJGSLDHBOPDRJ-RKDXNWHRSA-N |
| XLogP | 1.18 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |