C17H16Cl2N2O — CID 124503943
(3S,4R)-3-amino-1-(3,4-dichlorophenyl)-4-(4-ethylphenyl)azetidin-2-one (PubChem CID 124503943) has the molecular formula C17H16Cl2N2O and a molecular weight of 335.23 g/mol. Its IUPAC name is (3S,4R)-3-amino-1-(3,4-dichlorophenyl)-4-(4-ethylphenyl)azetidin-2-one.
| Compound Name | (3S,4R)-3-amino-1-(3,4-dichlorophenyl)-4-(4-ethylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 124503943 |
| Molecular Formula | C17H16Cl2N2O |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | (3S,4R)-3-amino-1-(3,4-dichlorophenyl)-4-(4-ethylphenyl)azetidin-2-one |
| SMILES | CCc1ccc([C@@H]2[C@H](N)C(=O)N2c2ccc(Cl)c(Cl)c2)cc1 |
| InChI | InChI=1S/C17H16Cl2N2O/c1-2-10-3-5-11(6-4-10)16-15(20)17(22)21(16)12-7-8-13(18)14(19)9-12/h3-9,15-16H,2,20H2,1H3/t15-,16+/m0/s1 |
| InChIKey | PYTVKHOJNPMDIL-JKSUJKDBSA-N |
| XLogP | 3.97 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |