C17H17BrN2O — CID 124503973
(3R,4R)-3-amino-4-(4-bromophenyl)-1-(3,4-dimethylphenyl)azetidin-2-one (PubChem CID 124503973) has the molecular formula C17H17BrN2O and a molecular weight of 345.24 g/mol. Its IUPAC name is (3R,4R)-3-amino-4-(4-bromophenyl)-1-(3,4-dimethylphenyl)azetidin-2-one.
| Compound Name | (3R,4R)-3-amino-4-(4-bromophenyl)-1-(3,4-dimethylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 124503973 |
| Molecular Formula | C17H17BrN2O |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | (3R,4R)-3-amino-4-(4-bromophenyl)-1-(3,4-dimethylphenyl)azetidin-2-one |
| SMILES | Cc1ccc(N2C(=O)[C@H](N)[C@H]2c2ccc(Br)cc2)cc1C |
| InChI | InChI=1S/C17H17BrN2O/c1-10-3-8-14(9-11(10)2)20-16(15(19)17(20)21)12-4-6-13(18)7-5-12/h3-9,15-16H,19H2,1-2H3/t15-,16-/m1/s1 |
| InChIKey | ADIYVTWVBNPUSW-HZPDHXFCSA-N |
| XLogP | 3.48 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |