C17H16N2O3 — CID 102536959
3-amino-1-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)azetidin-2-one (PubChem CID 102536959) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-amino-1-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)azetidin-2-one.
| Compound Name | 3-amino-1-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)azetidin-2-one |
|---|---|
| PubChem CID | 102536959 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 3-amino-1-(1,3-benzodioxol-5-yl)-4-(4-methylphenyl)azetidin-2-one |
| SMILES | Cc1ccc(C2C(N)C(=O)N2c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H16N2O3/c1-10-2-4-11(5-3-10)16-15(18)17(20)19(16)12-6-7-13-14(8-12)22-9-21-13/h2-8,15-16H,9,18H2,1H3 |
| InChIKey | UQRUKIMKBPJUPX-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |