C17H14N2O5 — CID 124503701
(3R,4R)-3-amino-1,4-bis(1,3-benzodioxol-5-yl)azetidin-2-one (PubChem CID 124503701) has the molecular formula C17H14N2O5 and a molecular weight of 326.31 g/mol. Its IUPAC name is (3R,4R)-3-amino-1,4-bis(1,3-benzodioxol-5-yl)azetidin-2-one.
| Compound Name | (3R,4R)-3-amino-1,4-bis(1,3-benzodioxol-5-yl)azetidin-2-one |
|---|---|
| PubChem CID | 124503701 |
| Molecular Formula | C17H14N2O5 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | (3R,4R)-3-amino-1,4-bis(1,3-benzodioxol-5-yl)azetidin-2-one |
| SMILES | N[C@H]1C(=O)N(c2ccc3c(c2)OCO3)[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N2O5/c18-15-16(9-1-3-11-13(5-9)23-7-21-11)19(17(15)20)10-2-4-12-14(6-10)24-8-22-12/h1-6,15-16H,7-8,18H2/t15-,16-/m1/s1 |
| InChIKey | GTAINGLNQBNMFF-HZPDHXFCSA-N |
| XLogP | 1.56 |
| TPSA | 83.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |