C11H11N3O4 — CID 45041096
6-amino-1-(1,3-benzodioxol-5-yl)-1,3-diazinane-2,4-dione (PubChem CID 45041096) has the molecular formula C11H11N3O4 and a molecular weight of 249.23 g/mol. Its IUPAC name is 6-amino-1-(1,3-benzodioxol-5-yl)-1,3-diazinane-2,4-dione.
| Compound Name | 6-amino-1-(1,3-benzodioxol-5-yl)-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 45041096 |
| Molecular Formula | C11H11N3O4 |
| Molecular Weight | 249.23 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 6-amino-1-(1,3-benzodioxol-5-yl)-1,3-diazinane-2,4-dione |
| SMILES | NC1CC(=O)NC(=O)N1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H11N3O4/c12-9-4-10(15)13-11(16)14(9)6-1-2-7-8(3-6)18-5-17-7/h1-3,9H,4-5,12H2,(H,13,15,16) |
| InChIKey | QMRPTVSBRLLHSX-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.23 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |