C10H7N3O4S — CID 155805022
3-(1,3-benzodioxol-5-yl)-6-sulfanylidene-1,3,5-triazinane-2,4-dione (PubChem CID 155805022) has the molecular formula C10H7N3O4S and a molecular weight of 265.25 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-6-sulfanylidene-1,3,5-triazinane-2,4-dione.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-6-sulfanylidene-1,3,5-triazinane-2,4-dione |
|---|---|
| PubChem CID | 155805022 |
| Molecular Formula | C10H7N3O4S |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-6-sulfanylidene-1,3,5-triazinane-2,4-dione |
| SMILES | O=c1[nH]c(=S)[nH]c(=O)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C10H7N3O4S/c14-9-11-8(18)12-10(15)13(9)5-1-2-6-7(3-5)17-4-16-6/h1-3H,4H2,(H2,11,12,14,15,18) |
| InChIKey | KRVBQDSWGAHAGL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 89.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|