C11H12N2O3 — CID 115370915
1-(1,3-benzodioxol-5-yl)-1,3-diazinan-2-one (PubChem CID 115370915) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-1,3-diazinan-2-one.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115370915 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H12N2O3/c14-11-12-4-1-5-13(11)8-2-3-9-10(6-8)16-7-15-9/h2-3,6H,1,4-5,7H2,(H,12,14) |
| InChIKey | DJOSTKWORMLXSN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |