C12H15NO2 — CID 15712176
1-(1,3-benzodioxol-5-yl)piperidine (PubChem CID 15712176) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)piperidine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)piperidine |
|---|---|
| PubChem CID | 15712176 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)piperidine |
| SMILES | c1cc2c(cc1N1CCCCC1)OCO2 |
| InChI | InChI=1S/C12H15NO2/c1-2-6-13(7-3-1)10-4-5-11-12(8-10)15-9-14-11/h4-5,8H,1-3,6-7,9H2 |
| InChIKey | WGBHHTBRVCAJOH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|