C13H15NO4 — CID 59023367
1-(1,3-benzodioxol-5-yl)piperidine-4-carboxylic acid (PubChem CID 59023367) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)piperidine-4-carboxylic acid.
| Compound Name | 1-(1,3-benzodioxol-5-yl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 59023367 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C13H15NO4/c15-13(16)9-3-5-14(6-4-9)10-1-2-11-12(7-10)18-8-17-11/h1-2,7,9H,3-6,8H2,(H,15,16) |
| InChIKey | WRKRFUGDZNPGPM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|