C18H24N2O3 — CID 113079595
[4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-cyclohexylmethanone (PubChem CID 113079595) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is [4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-cyclohexylmethanone.
| Compound Name | [4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 113079595 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | [4-(1,3-benzodioxol-5-yl)piperazin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)N1CCN(c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H24N2O3/c21-18(14-4-2-1-3-5-14)20-10-8-19(9-11-20)15-6-7-16-17(12-15)23-13-22-16/h6-7,12,14H,1-5,8-11,13H2 |
| InChIKey | SVDSLBJXOIEGKE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|