C17H23ClN2O — CID 798144
[4-(3-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone (PubChem CID 798144) has the molecular formula C17H23ClN2O and a molecular weight of 306.84 g/mol. Its IUPAC name is [4-(3-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone.
| Compound Name | [4-(3-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone |
|---|---|
| PubChem CID | 798144 |
| Molecular Formula | C17H23ClN2O |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | [4-(3-chlorophenyl)piperazin-1-yl]-cyclohexylmethanone |
| SMILES | O=C(C1CCCCC1)N1CCN(c2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C17H23ClN2O/c18-15-7-4-8-16(13-15)19-9-11-20(12-10-19)17(21)14-5-2-1-3-6-14/h4,7-8,13-14H,1-3,5-6,9-12H2 |
| InChIKey | IHNWKHJTBPDQCQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |