C16H20ClN3O2 — CID 90513796
1-[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]azetidin-1-yl]ethanone (PubChem CID 90513796) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]azetidin-1-yl]ethanone.
| Compound Name | 1-[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]azetidin-1-yl]ethanone |
|---|---|
| PubChem CID | 90513796 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[3-[4-(3-chlorophenyl)piperazine-1-carbonyl]azetidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC(C(=O)N2CCN(c3cccc(Cl)c3)CC2)C1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-12(21)20-10-13(11-20)16(22)19-7-5-18(6-8-19)15-4-2-3-14(17)9-15/h2-4,9,13H,5-8,10-11H2,1H3 |
| InChIKey | KLWRJIQIYCMPCA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |