C14H18N2O4 — CID 83981792
2-amino-3-[1-(1,3-benzodioxol-5-yl)pyrrolidin-3-yl]propanoic acid (PubChem CID 83981792) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-amino-3-[1-(1,3-benzodioxol-5-yl)pyrrolidin-3-yl]propanoic acid.
| Compound Name | 2-amino-3-[1-(1,3-benzodioxol-5-yl)pyrrolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 83981792 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-amino-3-[1-(1,3-benzodioxol-5-yl)pyrrolidin-3-yl]propanoic acid |
| SMILES | NC(CC1CCN(c2ccc3c(c2)OCO3)C1)C(=O)O |
| InChI | InChI=1S/C14H18N2O4/c15-11(14(17)18)5-9-3-4-16(7-9)10-1-2-12-13(6-10)20-8-19-12/h1-2,6,9,11H,3-5,7-8,15H2,(H,17,18) |
| InChIKey | NXPLXXQKOAKRTP-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|