C28H29N3O6 — CID 129310649
benzyl N-[1-(1,3-benzodioxol-5-yl)piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 129310649) has the molecular formula C28H29N3O6 and a molecular weight of 503.56 g/mol. Its IUPAC name is benzyl N-[1-(1,3-benzodioxol-5-yl)piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[1-(1,3-benzodioxol-5-yl)piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 129310649 |
| Molecular Formula | C28H29N3O6 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.21 |
| IUPAC Name | benzyl N-[1-(1,3-benzodioxol-5-yl)piperidin-3-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | O=C(NN(C(=O)OCc1ccccc1)C1CCCN(c2ccc3c(c2)OCO3)C1)OCc1ccccc1 |
| InChI | InChI=1S/C28H29N3O6/c32-27(34-18-21-8-3-1-4-9-21)29-31(28(33)35-19-22-10-5-2-6-11-22)24-12-7-15-30(17-24)23-13-14-25-26(16-23)37-20-36-25/h1-6,8-11,13-14,16,24H,7,12,15,17-20H2,(H,29,32) |
| InChIKey | ZUAQZMFHDRYURE-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 89.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|