C23H25NO4 — CID 10045267
benzyl (3aR,7S,7aS)-7-(1,3-benzodioxol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate (PubChem CID 10045267) has the molecular formula C23H25NO4 and a molecular weight of 379.46 g/mol. Its IUPAC name is benzyl (3aR,7S,7aS)-7-(1,3-benzodioxol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate.
| Compound Name | benzyl (3aR,7S,7aS)-7-(1,3-benzodioxol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
|---|---|
| PubChem CID | 10045267 |
| Molecular Formula | C23H25NO4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | benzyl (3aR,7S,7aS)-7-(1,3-benzodioxol-5-yl)-2,3,3a,4,5,6,7,7a-octahydroindole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H]2CCC[C@@H](c3ccc4c(c3)OCO4)[C@H]21 |
| InChI | InChI=1S/C23H25NO4/c25-23(26-14-16-5-2-1-3-6-16)24-12-11-17-7-4-8-19(22(17)24)18-9-10-20-21(13-18)28-15-27-20/h1-3,5-6,9-10,13,17,19,22H,4,7-8,11-12,14-15H2/t17-,19+,22+/m1/s1 |
| InChIKey | FMYVBRKIAKNKAT-LZNRXBQRSA-N |
| XLogP | 4.71 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |