C26H23NO4 — CID 122576798
benzyl (1R,8R)-5-(1,3-benzodioxol-5-yl)-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate (PubChem CID 122576798) has the molecular formula C26H23NO4 and a molecular weight of 413.47 g/mol. Its IUPAC name is benzyl (1R,8R)-5-(1,3-benzodioxol-5-yl)-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate.
| Compound Name | benzyl (1R,8R)-5-(1,3-benzodioxol-5-yl)-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate |
|---|---|
| PubChem CID | 122576798 |
| Molecular Formula | C26H23NO4 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | benzyl (1R,8R)-5-(1,3-benzodioxol-5-yl)-9-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene-9-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@H]2C[C@@H]1c1cc(-c3ccc4c(c3)OCO4)ccc12 |
| InChI | InChI=1S/C26H23NO4/c28-26(29-15-17-4-2-1-3-5-17)27-11-10-20-13-23(27)22-12-18(6-8-21(20)22)19-7-9-24-25(14-19)31-16-30-24/h1-9,12,14,20,23H,10-11,13,15-16H2/t20-,23-/m1/s1 |
| InChIKey | DLVOOBPECZYQPY-NFBKMPQASA-N |
| XLogP | 5.65 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |