C28H27N3O6 — CID 118541861
dibenzyl 3-(1,3-benzodioxol-5-yl)-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate (PubChem CID 118541861) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is dibenzyl 3-(1,3-benzodioxol-5-yl)-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate.
| Compound Name | dibenzyl 3-(1,3-benzodioxol-5-yl)-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate |
|---|---|
| PubChem CID | 118541861 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | dibenzyl 3-(1,3-benzodioxol-5-yl)-3,6,7-triazabicyclo[3.2.1]octane-6,7-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)N1C2CC(CN(c3ccc4c(c3)OCO4)C2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H27N3O6/c32-27(34-17-20-7-3-1-4-8-20)30-23-13-24(31(30)28(33)35-18-21-9-5-2-6-10-21)16-29(15-23)22-11-12-25-26(14-22)37-19-36-25/h1-12,14,23-24H,13,15-19H2 |
| InChIKey | DITYSAYYZRGAND-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|