C29H31NO4 — CID 159281213
benzyl 4-[4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)azetidin-3-yl]phenyl]-3-methylbutanoate (PubChem CID 159281213) has the molecular formula C29H31NO4 and a molecular weight of 457.57 g/mol. Its IUPAC name is benzyl 4-[4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)azetidin-3-yl]phenyl]-3-methylbutanoate.
| Compound Name | benzyl 4-[4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)azetidin-3-yl]phenyl]-3-methylbutanoate |
|---|---|
| PubChem CID | 159281213 |
| Molecular Formula | C29H31NO4 |
| Molecular Weight | 457.57 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | benzyl 4-[4-[1-(2,3-dihydro-1,4-benzodioxin-6-yl)azetidin-3-yl]phenyl]-3-methylbutanoate |
| SMILES | CC(CC(=O)OCc1ccccc1)Cc1ccc(C2CN(c3ccc4c(c3)OCCO4)C2)cc1 |
| InChI | InChI=1S/C29H31NO4/c1-21(16-29(31)34-20-23-5-3-2-4-6-23)15-22-7-9-24(10-8-22)25-18-30(19-25)26-11-12-27-28(17-26)33-14-13-32-27/h2-12,17,21,25H,13-16,18-20H2,1H3 |
| InChIKey | KYYBUUGJWIROHN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.57 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|