benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate

C17H14O5 — CID 134392561

IUPACbenzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate
SMILESO=C(Cc1ccc2c(c1)OCO2)C(=O)OCc1ccccc1
InChIInChI=1S/C17H14O5/c18-14(17(19)20-10-12-4-2-1-3-5-12)8-13-6-7-15-16(9-13)22-11-21-15/h1-7,9H,8,10-11H2
InChIKeyCYOCQIYPXWIHBL-UHFFFAOYSA-N
MW298.29 g/mol
LogP2.27
Rot. Bonds5

About benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate

benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate (PubChem CID 134392561) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate.

Molecular Properties

Compound Namebenzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate
PubChem CID134392561
Molecular FormulaC17H14O5
Molecular Weight298.29 g/mol
Exact Mass298.08
IUPAC Namebenzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate
SMILESO=C(Cc1ccc2c(c1)OCO2)C(=O)OCc1ccccc1
InChIInChI=1S/C17H14O5/c18-14(17(19)20-10-12-4-2-1-3-5-12)8-13-6-7-15-16(9-13)22-11-21-15/h1-7,9H,8,10-11H2
InChIKeyCYOCQIYPXWIHBL-UHFFFAOYSA-N
XLogP2.27
TPSA61.83 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.29
LogP ≤ 52.27
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate?
The IUPAC name of benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate (CID 134392561) is benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate.
What is the SMILES notation for benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate?
The canonical SMILES for benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate is O=C(Cc1ccc2c(c1)OCO2)C(=O)OCc1ccccc1.
What is the InChIKey of benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate?
The InChIKey is CYOCQIYPXWIHBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14O5/c18-14(17(19)20-10-12-4-2-1-3-5-12)8-13-6-7-15-16(9-13)22-11-21-15/h1-7,9H,8,10-11H2.
What are the key properties of benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate?
benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate has a molecular weight of 298.29 g/mol, XLogP of 2.27, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 3-(1,3-benzodioxol-5-yl)-2-oxopropanoate is sourced from PubChem (CID 134392561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).