C15H15NO3 — CID 86077029
N-(1,3-benzodioxol-5-ylmethyl)-N-benzylhydroxylamine (PubChem CID 86077029) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-benzylhydroxylamine.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-benzylhydroxylamine |
|---|---|
| PubChem CID | 86077029 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-benzylhydroxylamine |
| SMILES | ON(Cc1ccccc1)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H15NO3/c17-16(9-12-4-2-1-3-5-12)10-13-6-7-14-15(8-13)19-11-18-14/h1-8,17H,9-11H2 |
| InChIKey | HCKXNUIUQMAJFU-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|