C14H12INO2 — CID 163476763
N-benzyl-N-iodo-1,3-benzodioxol-5-amine (PubChem CID 163476763) has the molecular formula C14H12INO2 and a molecular weight of 353.16 g/mol. Its IUPAC name is N-benzyl-N-iodo-1,3-benzodioxol-5-amine.
| Compound Name | N-benzyl-N-iodo-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 163476763 |
| Molecular Formula | C14H12INO2 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | N-benzyl-N-iodo-1,3-benzodioxol-5-amine |
| SMILES | IN(Cc1ccccc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12INO2/c15-16(9-11-4-2-1-3-5-11)12-6-7-13-14(8-12)18-10-17-13/h1-8H,9-10H2 |
| InChIKey | CBCBOORLMPFDAZ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|