C22H20N2O3 — CID 112982312
N-[4-[benzyl(methyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 112982312) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-[benzyl(methyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 112982312 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | N-[4-[benzyl(methyl)amino]phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CN(Cc1ccccc1)c1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C22H20N2O3/c1-24(14-16-5-3-2-4-6-16)19-10-8-18(9-11-19)23-22(25)17-7-12-20-21(13-17)27-15-26-20/h2-13H,14-15H2,1H3,(H,23,25) |
| InChIKey | PXOJRBNCKNWTDO-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|