C23H24N2O3 — CID 112982300
N-[4-[benzyl(methyl)amino]phenyl]-3,4-dimethoxybenzamide (PubChem CID 112982300) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[4-[benzyl(methyl)amino]phenyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[4-[benzyl(methyl)amino]phenyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 112982300 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[4-[benzyl(methyl)amino]phenyl]-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(N(C)Cc3ccccc3)cc2)cc1OC |
| InChI | InChI=1S/C23H24N2O3/c1-25(16-17-7-5-4-6-8-17)20-12-10-19(11-13-20)24-23(26)18-9-14-21(27-2)22(15-18)28-3/h4-15H,16H2,1-3H3,(H,24,26) |
| InChIKey | DUDJKWQADCHESS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|