C28H23NO4 — CID 139779423
N-(4-benzoylphenyl)-3-methoxy-4-phenylmethoxybenzamide (PubChem CID 139779423) has the molecular formula C28H23NO4 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-(4-benzoylphenyl)-3-methoxy-4-phenylmethoxybenzamide.
| Compound Name | N-(4-benzoylphenyl)-3-methoxy-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 139779423 |
| Molecular Formula | C28H23NO4 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-(4-benzoylphenyl)-3-methoxy-4-phenylmethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)c3ccccc3)cc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C28H23NO4/c1-32-26-18-23(14-17-25(26)33-19-20-8-4-2-5-9-20)28(31)29-24-15-12-22(13-16-24)27(30)21-10-6-3-7-11-21/h2-18H,19H2,1H3,(H,29,31) |
| InChIKey | QSCMKDRUJYHADQ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |