C25H22N2O4 — CID 122188015
4-methoxy-3-phenylmethoxy-N-[4-(prop-2-ynylcarbamoyl)phenyl]benzamide (PubChem CID 122188015) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is 4-methoxy-3-phenylmethoxy-N-[4-(prop-2-ynylcarbamoyl)phenyl]benzamide.
| Compound Name | 4-methoxy-3-phenylmethoxy-N-[4-(prop-2-ynylcarbamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 122188015 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-methoxy-3-phenylmethoxy-N-[4-(prop-2-ynylcarbamoyl)phenyl]benzamide |
| SMILES | C#CCNC(=O)c1ccc(NC(=O)c2ccc(OC)c(OCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H22N2O4/c1-3-15-26-24(28)19-9-12-21(13-10-19)27-25(29)20-11-14-22(30-2)23(16-20)31-17-18-7-5-4-6-8-18/h1,4-14,16H,15,17H2,2H3,(H,26,28)(H,27,29) |
| InChIKey | XIRWUJAHRPTQBK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|