C28H31NO4 — CID 139779558
4-(cyclohexylmethoxy)-3-methoxy-N-(4-phenylmethoxyphenyl)benzamide (PubChem CID 139779558) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 4-(cyclohexylmethoxy)-3-methoxy-N-(4-phenylmethoxyphenyl)benzamide.
| Compound Name | 4-(cyclohexylmethoxy)-3-methoxy-N-(4-phenylmethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 139779558 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 4-(cyclohexylmethoxy)-3-methoxy-N-(4-phenylmethoxyphenyl)benzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(OCc3ccccc3)cc2)ccc1OCC1CCCCC1 |
| InChI | InChI=1S/C28H31NO4/c1-31-27-18-23(12-17-26(27)33-20-22-10-6-3-7-11-22)28(30)29-24-13-15-25(16-14-24)32-19-21-8-4-2-5-9-21/h2,4-5,8-9,12-18,22H,3,6-7,10-11,19-20H2,1H3,(H,29,30) |
| InChIKey | MAFBLVSTYYBMBP-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |