C17H16N2O4 — CID 22299162
N-[4-(2-oxopropylamino)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 22299162) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-[4-(2-oxopropylamino)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(2-oxopropylamino)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 22299162 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-[4-(2-oxopropylamino)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CC(=O)CNc1ccc(NC(=O)c2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H16N2O4/c1-11(20)9-18-13-3-5-14(6-4-13)19-17(21)12-2-7-15-16(8-12)23-10-22-15/h2-8,18H,9-10H2,1H3,(H,19,21) |
| InChIKey | FPSCCTLNHFGDBT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |