C15H11N5O3 — CID 110743272
N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 110743272) has the molecular formula C15H11N5O3 and a molecular weight of 309.29 g/mol. Its IUPAC name is N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 110743272 |
| Molecular Formula | C15H11N5O3 |
| Molecular Weight | 309.29 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | N-[4-(2H-tetrazol-5-yl)phenyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nn[nH]n2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11N5O3/c21-15(10-3-6-12-13(7-10)23-8-22-12)16-11-4-1-9(2-5-11)14-17-19-20-18-14/h1-7H,8H2,(H,16,21)(H,17,18,19,20) |
| InChIKey | JJLDTSXIWQBXQU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 102.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.29 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |