C25H26N2O4 — CID 19369982
N,N'-bis(1,3-benzodioxol-5-ylmethyl)-N'-benzylethane-1,2-diamine (PubChem CID 19369982) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N,N'-bis(1,3-benzodioxol-5-ylmethyl)-N'-benzylethane-1,2-diamine.
| Compound Name | N,N'-bis(1,3-benzodioxol-5-ylmethyl)-N'-benzylethane-1,2-diamine |
|---|---|
| PubChem CID | 19369982 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N,N'-bis(1,3-benzodioxol-5-ylmethyl)-N'-benzylethane-1,2-diamine |
| SMILES | c1ccc(CN(CCNCc2ccc3c(c2)OCO3)Cc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-2-4-19(5-3-1)15-27(16-21-7-9-23-25(13-21)31-18-29-23)11-10-26-14-20-6-8-22-24(12-20)30-17-28-22/h1-9,12-13,26H,10-11,14-18H2 |
| InChIKey | FFRQQTONCXVRHM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|