C17H19NO2 — CID 141068575
3-(1,3-benzodioxol-5-yl)-N-benzylpropan-1-amine (PubChem CID 141068575) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-benzylpropan-1-amine.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-benzylpropan-1-amine |
|---|---|
| PubChem CID | 141068575 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-benzylpropan-1-amine |
| SMILES | c1ccc(CNCCCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C17H19NO2/c1-2-5-15(6-3-1)12-18-10-4-7-14-8-9-16-17(11-14)20-13-19-16/h1-3,5-6,8-9,11,18H,4,7,10,12-13H2 |
| InChIKey | DYTMRTHJPKOUSK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|