C12H17NO3 — CID 171619202
2-[3-(1,3-benzodioxol-5-yl)propylamino]ethanol (PubChem CID 171619202) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 2-[3-(1,3-benzodioxol-5-yl)propylamino]ethanol.
| Compound Name | 2-[3-(1,3-benzodioxol-5-yl)propylamino]ethanol |
|---|---|
| PubChem CID | 171619202 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 2-[3-(1,3-benzodioxol-5-yl)propylamino]ethanol |
| SMILES | OCCNCCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H17NO3/c14-7-6-13-5-1-2-10-3-4-11-12(8-10)16-9-15-11/h3-4,8,13-14H,1-2,5-7,9H2 |
| InChIKey | GBTVLNYWOFVNMK-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|