C17H16BrNO3 — CID 110371214
N-[3-(1,3-benzodioxol-5-yl)propyl]-2-bromobenzamide (PubChem CID 110371214) has the molecular formula C17H16BrNO3 and a molecular weight of 362.22 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-yl)propyl]-2-bromobenzamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-yl)propyl]-2-bromobenzamide |
|---|---|
| PubChem CID | 110371214 |
| Molecular Formula | C17H16BrNO3 |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-yl)propyl]-2-bromobenzamide |
| SMILES | O=C(NCCCc1ccc2c(c1)OCO2)c1ccccc1Br |
| InChI | InChI=1S/C17H16BrNO3/c18-14-6-2-1-5-13(14)17(20)19-9-3-4-12-7-8-15-16(10-12)22-11-21-15/h1-2,5-8,10H,3-4,9,11H2,(H,19,20) |
| InChIKey | BHUJWYSQJGLCTK-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|