C16H13BrFNO3 — CID 18117976
N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-bromo-2-fluorobenzamide (PubChem CID 18117976) has the molecular formula C16H13BrFNO3 and a molecular weight of 366.19 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-bromo-2-fluorobenzamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-bromo-2-fluorobenzamide |
|---|---|
| PubChem CID | 18117976 |
| Molecular Formula | C16H13BrFNO3 |
| Molecular Weight | 366.19 g/mol |
| Exact Mass | 365.01 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-4-bromo-2-fluorobenzamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)c1ccc(Br)cc1F |
| InChI | InChI=1S/C16H13BrFNO3/c17-11-2-3-12(13(18)8-11)16(20)19-6-5-10-1-4-14-15(7-10)22-9-21-14/h1-4,7-8H,5-6,9H2,(H,19,20) |
| InChIKey | IPNWCXOZXINXJK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.19 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |