C19H18F2N2O4 — CID 51192543
N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-2,4-difluorobenzamide (PubChem CID 51192543) has the molecular formula C19H18F2N2O4 and a molecular weight of 376.36 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-2,4-difluorobenzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 51192543 |
| Molecular Formula | C19H18F2N2O4 |
| Molecular Weight | 376.36 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]-2,4-difluorobenzamide |
| SMILES | O=C(CCCNC(=O)c1ccc(F)cc1F)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18F2N2O4/c20-13-4-5-14(15(21)9-13)19(25)22-7-1-2-18(24)23-10-12-3-6-16-17(8-12)27-11-26-16/h3-6,8-9H,1-2,7,10-11H2,(H,22,25)(H,23,24) |
| InChIKey | IDOKUCRVYWEING-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.36 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|