C19H18FNO4 — CID 110298086
N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-5-oxopentanamide (PubChem CID 110298086) has the molecular formula C19H18FNO4 and a molecular weight of 343.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-5-oxopentanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 110298086 |
| Molecular Formula | C19H18FNO4 |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-5-(4-fluorophenyl)-5-oxopentanamide |
| SMILES | O=C(CCCC(=O)c1ccc(F)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18FNO4/c20-15-7-5-14(6-8-15)16(22)2-1-3-19(23)21-11-13-4-9-17-18(10-13)25-12-24-17/h4-10H,1-3,11-12H2,(H,21,23) |
| InChIKey | AUPCZJQBFCGLRD-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |