C19H20N2O4 — CID 39753224
N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]benzamide (PubChem CID 39753224) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]benzamide.
| Compound Name | N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]benzamide |
|---|---|
| PubChem CID | 39753224 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[4-(1,3-benzodioxol-5-ylmethylamino)-4-oxobutyl]benzamide |
| SMILES | O=C(CCCNC(=O)c1ccccc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H20N2O4/c22-18(7-4-10-20-19(23)15-5-2-1-3-6-15)21-12-14-8-9-16-17(11-14)25-13-24-16/h1-3,5-6,8-9,11H,4,7,10,12-13H2,(H,20,23)(H,21,22) |
| InChIKey | GZCULMBDKVSNPC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|