C21H21ClN2O6 — CID 2535645
[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate (PubChem CID 2535645) has the molecular formula C21H21ClN2O6 and a molecular weight of 432.86 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 2535645 |
| Molecular Formula | C21H21ClN2O6 |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl] 4-[(4-chlorobenzoyl)amino]butanoate |
| SMILES | O=C(COC(=O)CCCNC(=O)c1ccc(Cl)cc1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H21ClN2O6/c22-16-6-4-15(5-7-16)21(27)23-9-1-2-20(26)28-12-19(25)24-11-14-3-8-17-18(10-14)30-13-29-17/h3-8,10H,1-2,9,11-13H2,(H,23,27)(H,24,25) |
| InChIKey | GWKSMLBBSKSKPF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|