C18H17ClN2O4 — CID 18159580
N-[2-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl]-4-chlorobenzamide (PubChem CID 18159580) has the molecular formula C18H17ClN2O4 and a molecular weight of 360.80 g/mol. Its IUPAC name is N-[2-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl]-4-chlorobenzamide.
| Compound Name | N-[2-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 18159580 |
| Molecular Formula | C18H17ClN2O4 |
| Molecular Weight | 360.80 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[2-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-oxoethyl]-4-chlorobenzamide |
| SMILES | O=C(CNC(=O)c1ccc(Cl)cc1)NCCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H17ClN2O4/c19-14-4-2-13(3-5-14)18(23)21-10-17(22)20-8-7-12-1-6-15-16(9-12)25-11-24-15/h1-6,9H,7-8,10-11H2,(H,20,22)(H,21,23) |
| InChIKey | GDJMYMKUQLZNMA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.80 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |