C23H19ClN2O4 — CID 31967410
N-[2-[3-(1,3-benzodioxol-5-yl)propanoylamino]phenyl]-4-chlorobenzamide (PubChem CID 31967410) has the molecular formula C23H19ClN2O4 and a molecular weight of 422.87 g/mol. Its IUPAC name is N-[2-[3-(1,3-benzodioxol-5-yl)propanoylamino]phenyl]-4-chlorobenzamide.
| Compound Name | N-[2-[3-(1,3-benzodioxol-5-yl)propanoylamino]phenyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 31967410 |
| Molecular Formula | C23H19ClN2O4 |
| Molecular Weight | 422.87 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-[2-[3-(1,3-benzodioxol-5-yl)propanoylamino]phenyl]-4-chlorobenzamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)Nc1ccccc1NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2O4/c24-17-9-7-16(8-10-17)23(28)26-19-4-2-1-3-18(19)25-22(27)12-6-15-5-11-20-21(13-15)30-14-29-20/h1-5,7-11,13H,6,12,14H2,(H,25,27)(H,26,28) |
| InChIKey | ABGJAPZROCJPRE-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.87 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |