C16H12F3NO3 — CID 16574669
3-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 16574669) has the molecular formula C16H12F3NO3 and a molecular weight of 323.27 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 16574669 |
| Molecular Formula | C16H12F3NO3 |
| Molecular Weight | 323.27 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | O=C(CCc1ccc2c(c1)OCO2)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C16H12F3NO3/c17-10-3-4-11(16(19)15(10)18)20-14(21)6-2-9-1-5-12-13(7-9)23-8-22-12/h1,3-5,7H,2,6,8H2,(H,20,21) |
| InChIKey | SEMGQBKUFCBMBF-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|